C18H26N4O2S — CID 24525463
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 24525463) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24525463 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CN3CSCC3=O)cc2C)CC1 |
| InChI | InChI=1S/C18H26N4O2S/c1-3-20-6-8-21(9-7-20)16-5-4-15(10-14(16)2)19-17(23)11-22-13-25-12-18(22)24/h4-5,10H,3,6-9,11-13H2,1-2H3,(H,19,23) |
| InChIKey | JBIXGKIYTZHWMV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|