C25H30N4OS — CID 24525541
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 24525541) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 24525541 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cc3csc(-c4ccc(C)cc4)n3)cc2C)CC1 |
| InChI | InChI=1S/C25H30N4OS/c1-4-28-11-13-29(14-12-28)23-10-9-21(15-19(23)3)26-24(30)16-22-17-31-25(27-22)20-7-5-18(2)6-8-20/h5-10,15,17H,4,11-14,16H2,1-3H3,(H,26,30) |
| InChIKey | RDSFUYIHKOINOH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|