C29H30N4OS — CID 42314937
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 42314937) has the molecular formula C29H30N4OS and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 42314937 |
| Molecular Formula | C29H30N4OS |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(CC(=O)Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C29H30N4OS/c1-22-7-9-24(10-8-22)29-31-26(21-35-29)19-28(34)30-25-11-13-27(14-12-25)33-17-15-32(16-18-33)20-23-5-3-2-4-6-23/h2-14,21H,15-20H2,1H3,(H,30,34) |
| InChIKey | QOBHOFDOAICBDZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|