C27H28N4O2S — CID 46514320
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide (PubChem CID 46514320) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46514320 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H28N4O2S/c1-20-24(29-27(33-20)25-8-5-17-34-25)18-26(32)28-22-9-11-23(12-10-22)31-15-13-30(14-16-31)19-21-6-3-2-4-7-21/h2-12,17H,13-16,18-19H2,1H3,(H,28,32) |
| InChIKey | FFPYFIGGZHTDNT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|