C20H16N2O4S — CID 42937652
N-(4-methyl-2-oxochromen-7-yl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide (PubChem CID 42937652) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 42937652 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H16N2O4S/c1-11-8-19(24)26-16-9-13(5-6-14(11)16)21-18(23)10-15-12(2)25-20(22-15)17-4-3-7-27-17/h3-9H,10H2,1-2H3,(H,21,23) |
| InChIKey | JVHXHIJCBLWNHV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|