C18H12N2O4S — CID 17022321
N-(4-methyl-2-oxochromen-7-yl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 17022321) has the molecular formula C18H12N2O4S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17022321 |
| Molecular Formula | C18H12N2O4S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)c3cc(-c4cccs4)on3)ccc12 |
| InChI | InChI=1S/C18H12N2O4S/c1-10-7-17(21)23-14-8-11(4-5-12(10)14)19-18(22)13-9-15(24-20-13)16-3-2-6-25-16/h2-9H,1H3,(H,19,22) |
| InChIKey | XDFXBVHKLRQRON-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|