C20H20FN3O2S — CID 55889281
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide (PubChem CID 55889281) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55889281 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C20H20FN3O2S/c1-13-16(23-20(26-13)18-5-4-10-27-18)12-19(25)22-14-6-7-17(15(21)11-14)24-8-2-3-9-24/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,22,25) |
| InChIKey | DGJQONYDMCDRSV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|