C16H11Cl3N2O2S — CID 24627985
2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 24627985) has the molecular formula C16H11Cl3N2O2S and a molecular weight of 401.70 g/mol. Its IUPAC name is 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 24627985 |
| Molecular Formula | C16H11Cl3N2O2S |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3N2O2S/c1-8-12(21-16(23-8)14-3-2-4-24-14)7-15(22)20-13-6-10(18)9(17)5-11(13)19/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | QVIKRYNIMZPUKS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|