C19H18ClN3O3S — CID 55659288
2-chloro-N-[2-[[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]amino]ethyl]benzamide (PubChem CID 55659288) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659288 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-chloro-N-[2-[[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]amino]ethyl]benzamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3O3S/c1-12-15(23-19(26-12)16-7-4-10-27-16)11-17(24)21-8-9-22-18(25)13-5-2-3-6-14(13)20/h2-7,10H,8-9,11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | QOLVXECLTQTCTC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|