C28H30N6OS — CID 46537706
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 46537706) has the molecular formula C28H30N6OS and a molecular weight of 498.66 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46537706 |
| Molecular Formula | C28H30N6OS |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H30N6OS/c1-22-7-11-26(12-8-22)34-21-29-31-28(34)36-20-27(35)30-24-9-13-25(14-10-24)33-17-15-32(16-18-33)19-23-5-3-2-4-6-23/h2-14,21H,15-20H2,1H3,(H,30,35) |
| InChIKey | ZULRMHCHWKZGHY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|