C24H28N6OS — CID 24619093
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 24619093) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 24619093 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1C1CC1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N6OS/c31-23(17-32-24-27-25-18-30(24)22-10-11-22)26-20-6-8-21(9-7-20)29-14-12-28(13-15-29)16-19-4-2-1-3-5-19/h1-9,18,22H,10-17H2,(H,26,31) |
| InChIKey | YUEZTEXZAOPPCW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|