C22H24F3N7OS — CID 16619728
2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide (PubChem CID 16619728) has the molecular formula C22H24F3N7OS and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 16619728 |
| Molecular Formula | C22H24F3N7OS |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Nn1c(SCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N7OS/c23-22(24,25)20-28-29-21(32(20)26)34-15-19(33)27-17-6-8-18(9-7-17)31-12-10-30(11-13-31)14-16-4-2-1-3-5-16/h1-9H,10-15,26H2,(H,27,33) |
| InChIKey | YDZMVDXJFLOSHU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|