C25H26N6OS2 — CID 24622977
2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide (PubChem CID 24622977) has the molecular formula C25H26N6OS2 and a molecular weight of 490.66 g/mol. Its IUPAC name is 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 24622977 |
| Molecular Formula | C25H26N6OS2 |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Nc1nc(SCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)nc2sccc12 |
| InChI | InChI=1S/C25H26N6OS2/c26-23-21-10-15-33-24(21)29-25(28-23)34-17-22(32)27-19-6-8-20(9-7-19)31-13-11-30(12-14-31)16-18-4-2-1-3-5-18/h1-10,15H,11-14,16-17H2,(H,27,32)(H2,26,28,29) |
| InChIKey | GMZJGOZYCPVSDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|