C21H24N6OS2 — CID 51579867
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide (PubChem CID 51579867) has the molecular formula C21H24N6OS2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51579867 |
| Molecular Formula | C21H24N6OS2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-benzylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Nc1nnc(SCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)s1 |
| InChI | InChI=1S/C21H24N6OS2/c22-20-24-25-21(30-20)29-15-19(28)23-17-6-8-18(9-7-17)27-12-10-26(11-13-27)14-16-4-2-1-3-5-16/h1-9H,10-15H2,(H2,22,24)(H,23,28) |
| InChIKey | SWBITLKGIXWJKA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|