C22H25N5OS2 — CID 2400798
2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 2400798) has the molecular formula C22H25N5OS2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2400798 |
| Molecular Formula | C22H25N5OS2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(NCc2ccccc2)s1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N5OS2/c28-20(24-18-9-11-19(12-10-18)27-13-5-2-6-14-27)16-29-22-26-25-21(30-22)23-15-17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-16H2,(H,23,25)(H,24,28) |
| InChIKey | FDNGVMSWAFWGQF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|