C20H23N5OS2 — CID 46572885
2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 46572885) has the molecular formula C20H23N5OS2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46572885 |
| Molecular Formula | C20H23N5OS2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1sc2nc(SCC(=O)Nc3ccc(N4CCCC4)cc3)nc(N)c2c1C |
| InChI | InChI=1S/C20H23N5OS2/c1-12-13(2)28-19-17(12)18(21)23-20(24-19)27-11-16(26)22-14-5-7-15(8-6-14)25-9-3-4-10-25/h5-8H,3-4,9-11H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | FPJIDSMCHUCOHG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|