C21H25N5O2S2 — CID 46572840
2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 46572840) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 46572840 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1sc2nc(SC(C)C(=O)Nc3ccc(N4CCOCC4)cc3)nc(N)c2c1C |
| InChI | InChI=1S/C21H25N5O2S2/c1-12-13(2)29-20-17(12)18(22)24-21(25-20)30-14(3)19(27)23-15-4-6-16(7-5-15)26-8-10-28-11-9-26/h4-7,14H,8-11H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | REEJXVZQIOTXNH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|