C21H26N4O3S — CID 17445744
4,6-dimethyl-2-[1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]sulfanylpyridine-3-carboxamide (PubChem CID 17445744) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4,6-dimethyl-2-[1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]sulfanylpyridine-3-carboxamide.
| Compound Name | 4,6-dimethyl-2-[1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 17445744 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4,6-dimethyl-2-[1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]sulfanylpyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(N)=O)c(SC(C)C(=O)Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C21H26N4O3S/c1-13-12-14(2)23-21(18(13)19(22)26)29-15(3)20(27)24-16-4-6-17(7-5-16)25-8-10-28-11-9-25/h4-7,12,15H,8-11H2,1-3H3,(H2,22,26)(H,24,27) |
| InChIKey | YLLMZIOVOWVKJU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|