C15H19N5O2S2 — CID 2127030
(2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 2127030) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 2127030 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | C[C@H](Sc1nnc(N)s1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H19N5O2S2/c1-10(23-15-19-18-14(16)24-15)13(21)17-11-2-4-12(5-3-11)20-6-8-22-9-7-20/h2-5,10H,6-9H2,1H3,(H2,16,18)(H,17,21)/t10-/m0/s1 |
| InChIKey | KKTDVGJPSIKDCY-JTQLQIEISA-N |
| XLogP | 2.08 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|