C18H25N5O3S2 — CID 7275160
(2R)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 7275160) has the molecular formula C18H25N5O3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (2R)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 7275160 |
| Molecular Formula | C18H25N5O3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (2R)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | COCCNc1nnc(S[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C18H25N5O3S2/c1-13(27-18-22-21-17(28-18)19-7-10-25-2)16(24)20-14-3-5-15(6-4-14)23-8-11-26-12-9-23/h3-6,13H,7-12H2,1-2H3,(H,19,21)(H,20,24)/t13-/m1/s1 |
| InChIKey | MBPACJXSACPVJH-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|