C15H19N5O3S2 — CID 7485197
4-[[(2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]amino]benzamide (PubChem CID 7485197) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[[(2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 7485197 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[[(2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]amino]benzamide |
| SMILES | COCCNc1nnc(S[C@@H](C)C(=O)Nc2ccc(C(N)=O)cc2)s1 |
| InChI | InChI=1S/C15H19N5O3S2/c1-9(24-15-20-19-14(25-15)17-7-8-23-2)13(22)18-11-5-3-10(4-6-11)12(16)21/h3-6,9H,7-8H2,1-2H3,(H2,16,21)(H,17,19)(H,18,22)/t9-/m0/s1 |
| InChIKey | UVXOXYDLQULOPG-VIFPVBQESA-N |
| XLogP | 1.81 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|