C14H15F3N4O2S2 — CID 40613293
(2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 40613293) has the molecular formula C14H15F3N4O2S2 and a molecular weight of 392.43 g/mol. Its IUPAC name is (2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 40613293 |
| Molecular Formula | C14H15F3N4O2S2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (2S)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COCCNc1nnc(S[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C14H15F3N4O2S2/c1-7(24-14-21-20-13(25-14)18-5-6-23-2)12(22)19-9-4-3-8(15)10(16)11(9)17/h3-4,7H,5-6H2,1-2H3,(H,18,20)(H,19,22)/t7-/m0/s1 |
| InChIKey | LUCWHFVUBPUQMI-ZETCQYMHSA-N |
| XLogP | 3.13 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|