C14H16Cl2N4O2S2 — CID 42975441
N-(3,5-dichlorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 42975441) has the molecular formula C14H16Cl2N4O2S2 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 42975441 |
| Molecular Formula | C14H16Cl2N4O2S2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | COCCNc1nnc(SC(C)C(=O)Nc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C14H16Cl2N4O2S2/c1-8(12(21)18-11-6-9(15)5-10(16)7-11)23-14-20-19-13(24-14)17-3-4-22-2/h5-8H,3-4H2,1-2H3,(H,17,19)(H,18,21) |
| InChIKey | YAAXELMMIAJOIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|