C14H16BrN3O2S2 — CID 7969447
(2S)-1-(4-bromophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-one (PubChem CID 7969447) has the molecular formula C14H16BrN3O2S2 and a molecular weight of 402.34 g/mol. Its IUPAC name is (2S)-1-(4-bromophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(4-bromophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 7969447 |
| Molecular Formula | C14H16BrN3O2S2 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | (2S)-1-(4-bromophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-one |
| SMILES | COCCNc1nnc(S[C@@H](C)C(=O)c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C14H16BrN3O2S2/c1-9(12(19)10-3-5-11(15)6-4-10)21-14-18-17-13(22-14)16-7-8-20-2/h3-6,9H,7-8H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | ULPZNBAUQMMRDR-VIFPVBQESA-N |
| XLogP | 3.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|