C18H24N4O3S2 — CID 55445246
N-[2-[4-[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]phenyl]ethyl]acetamide (PubChem CID 55445246) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[2-[4-[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 55445246 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[2-[4-[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]phenyl]ethyl]acetamide |
| SMILES | COCCNc1nnc(SC(C)C(=O)c2ccc(CCNC(C)=O)cc2)s1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-12(26-18-22-21-17(27-18)20-10-11-25-3)16(24)15-6-4-14(5-7-15)8-9-19-13(2)23/h4-7,12H,8-11H2,1-3H3,(H,19,23)(H,20,21) |
| InChIKey | CFPYHEDDGCTPRG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|