C22H25N5O2S2 — CID 2125020
(2S)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 2125020) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is (2S)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 2125020 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (2S)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccc(Nc2nnc(S[C@@H](C)C(=O)Nc3ccc(N4CCOCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C22H25N5O2S2/c1-15-3-5-18(6-4-15)24-21-25-26-22(31-21)30-16(2)20(28)23-17-7-9-19(10-8-17)27-11-13-29-14-12-27/h3-10,16H,11-14H2,1-2H3,(H,23,28)(H,24,25)/t16-/m0/s1 |
| InChIKey | VIHZNLNYYWQDMK-INIZCTEOSA-N |
| XLogP | 4.55 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|