C22H24ClN5O2S2 — CID 24519280
2-[[5-(3-chloro-2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 24519280) has the molecular formula C22H24ClN5O2S2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 2-[[5-(3-chloro-2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[[5-(3-chloro-2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 24519280 |
| Molecular Formula | C22H24ClN5O2S2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[[5-(3-chloro-2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1c(Cl)cccc1Nc1nnc(SC(C)C(=O)Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C22H24ClN5O2S2/c1-14-18(23)4-3-5-19(14)25-21-26-27-22(32-21)31-15(2)20(29)24-16-6-8-17(9-7-16)28-10-12-30-13-11-28/h3-9,15H,10-13H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | HUEYUJNCOQXZPL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|