C18H25N5O2S2 — CID 7257254
(2R)-N-(4-morpholin-4-ylphenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7257254) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is (2R)-N-(4-morpholin-4-ylphenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7257254 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CC(C)Nc1nnc(S[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C18H25N5O2S2/c1-12(2)19-17-21-22-18(27-17)26-13(3)16(24)20-14-4-6-15(7-5-14)23-8-10-25-11-9-23/h4-7,12-13H,8-11H2,1-3H3,(H,19,21)(H,20,24)/t13-/m1/s1 |
| InChIKey | KKSHGXMUWGNQNJ-CYBMUJFWSA-N |
| XLogP | 3.31 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|