C15H18N4O2S2 — CID 7990405
(2S)-N-(4-morpholin-4-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide (PubChem CID 7990405) has the molecular formula C15H18N4O2S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (2S)-N-(4-morpholin-4-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 7990405 |
| Molecular Formula | C15H18N4O2S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1nncs1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H18N4O2S2/c1-11(23-15-18-16-10-22-15)14(20)17-12-2-4-13(5-3-12)19-6-8-21-9-7-19/h2-5,10-11H,6-9H2,1H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | NNPLXDZGSAFFNB-NSHDSACASA-N |
| XLogP | 2.49 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|