C22H26N6O2S — CID 41001171
(2R)-2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 41001171) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is (2R)-2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 41001171 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2R)-2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(-n2nnnc2S[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H26N6O2S/c1-15-4-5-16(2)20(14-15)28-22(24-25-26-28)31-17(3)21(29)23-18-6-8-19(9-7-18)27-10-12-30-13-11-27/h4-9,14,17H,10-13H2,1-3H3,(H,23,29)/t17-/m1/s1 |
| InChIKey | JVPJVOYVCUWROB-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|