C28H32N4O2S — CID 42311026
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide (PubChem CID 42311026) has the molecular formula C28H32N4O2S and a molecular weight of 488.66 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 42311026 |
| Molecular Formula | C28H32N4O2S |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C28H32N4O2S/c1-22-6-5-9-25(18-22)30-28(34)21-35-20-27(33)29-24-10-12-26(13-11-24)32-16-14-31(15-17-32)19-23-7-3-2-4-8-23/h2-13,18H,14-17,19-21H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | HXECGYXYLJHVJT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|