C20H25N4O2S+ — CID 9255116
N-(3-methylphenyl)-2-[2-oxo-2-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethyl]sulfanylacetamide (PubChem CID 9255116) has the molecular formula C20H25N4O2S+ and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[2-oxo-2-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethyl]sulfanylacetamide.
| Compound Name | N-(3-methylphenyl)-2-[2-oxo-2-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9255116 |
| Molecular Formula | C20H25N4O2S+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-(3-methylphenyl)-2-[2-oxo-2-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethyl]sulfanylacetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)N2CCN(c3cc[nH+]cc3)CC2)c1 |
| InChI | InChI=1S/C20H24N4O2S/c1-16-3-2-4-17(13-16)22-19(25)14-27-15-20(26)24-11-9-23(10-12-24)18-5-7-21-8-6-18/h2-8,13H,9-12,14-15H2,1H3,(H,22,25)/p+1 |
| InChIKey | CYIPZYUVPZHPNR-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |