C30H36N4O2 — CID 46669454
N-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]-4-tert-butylbenzamide (PubChem CID 46669454) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]-4-tert-butylbenzamide.
| Compound Name | N-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 46669454 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H36N4O2/c1-30(2,3)25-11-9-24(10-12-25)29(36)31-21-28(35)32-26-13-15-27(16-14-26)34-19-17-33(18-20-34)22-23-7-5-4-6-8-23/h4-16H,17-22H2,1-3H3,(H,31,36)(H,32,35) |
| InChIKey | WHVZLCHOGDOKBT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|