C24H28N6O — CID 55699535
N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(pyrimidin-2-ylamino)propanamide (PubChem CID 55699535) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(pyrimidin-2-ylamino)propanamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(pyrimidin-2-ylamino)propanamide |
|---|---|
| PubChem CID | 55699535 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(pyrimidin-2-ylamino)propanamide |
| SMILES | O=C(CCNc1ncccn1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N6O/c31-23(11-14-27-24-25-12-4-13-26-24)28-21-7-9-22(10-8-21)30-17-15-29(16-18-30)19-20-5-2-1-3-6-20/h1-10,12-13H,11,14-19H2,(H,28,31)(H,25,26,27) |
| InChIKey | WOJTYFKTVMDVRE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|