C26H30N6O3 — CID 46425538
[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 46425538) has the molecular formula C26H30N6O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 46425538 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCC(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)c1ncccn1 |
| InChI | InChI=1S/C26H30N6O3/c1-30(26-27-12-5-13-28-26)19-25(34)35-20-24(33)29-22-8-10-23(11-9-22)32-16-14-31(15-17-32)18-21-6-3-2-4-7-21/h2-13H,14-20H2,1H3,(H,29,33) |
| InChIKey | XREPWBPOKMXUED-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|