C27H28Cl3N3O2 — CID 17319465
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide (PubChem CID 17319465) has the molecular formula C27H28Cl3N3O2 and a molecular weight of 532.90 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17319465 |
| Molecular Formula | C27H28Cl3N3O2 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1c(Cl)c(C)c(Cl)c(OCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)c1Cl |
| InChI | InChI=1S/C27H28Cl3N3O2/c1-18-24(28)19(2)26(30)27(25(18)29)35-17-23(34)31-21-8-10-22(11-9-21)33-14-12-32(13-15-33)16-20-6-4-3-5-7-20/h3-11H,12-17H2,1-2H3,(H,31,34) |
| InChIKey | JETBPGAQEPEHFJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|