C23H19Cl3N2O3 — CID 17117574
N-[4-[[2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 17117574) has the molecular formula C23H19Cl3N2O3 and a molecular weight of 477.78 g/mol. Its IUPAC name is N-[4-[[2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[4-[[2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17117574 |
| Molecular Formula | C23H19Cl3N2O3 |
| Molecular Weight | 477.78 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-[4-[[2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | Cc1c(Cl)c(C)c(Cl)c(OCC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)c1Cl |
| InChI | InChI=1S/C23H19Cl3N2O3/c1-13-19(24)14(2)21(26)22(20(13)25)31-12-18(29)27-16-8-10-17(11-9-16)28-23(30)15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | HSDVHVAFGBAATB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |