C23H21NO3 — CID 1020136
N-(4-benzoylphenyl)-2-(2,6-dimethylphenoxy)acetamide (PubChem CID 1020136) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-2-(2,6-dimethylphenoxy)acetamide.
| Compound Name | N-(4-benzoylphenyl)-2-(2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 1020136 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(4-benzoylphenyl)-2-(2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-16-7-6-8-17(2)23(16)27-15-21(25)24-20-13-11-19(12-14-20)22(26)18-9-4-3-5-10-18/h3-14H,15H2,1-2H3,(H,24,25) |
| InChIKey | XVJFOUVNJRFVOW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |