C24H22N2O5 — CID 1298155
4-[[2-[[2-(2,6-dimethylphenoxy)acetyl]amino]benzoyl]amino]benzoic acid (PubChem CID 1298155) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[[2-[[2-(2,6-dimethylphenoxy)acetyl]amino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[2-(2,6-dimethylphenoxy)acetyl]amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1298155 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-[[2-[[2-(2,6-dimethylphenoxy)acetyl]amino]benzoyl]amino]benzoic acid |
| SMILES | Cc1cccc(C)c1OCC(=O)Nc1ccccc1C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-15-6-5-7-16(2)22(15)31-14-21(27)26-20-9-4-3-8-19(20)23(28)25-18-12-10-17(11-13-18)24(29)30/h3-13H,14H2,1-2H3,(H,25,28)(H,26,27)(H,29,30) |
| InChIKey | CRLRJFMZRYHFDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |