C23H20N2O6 — CID 2194345
4-[[2-[[2-(3-methoxyphenoxy)acetyl]amino]benzoyl]amino]benzoic acid (PubChem CID 2194345) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is 4-[[2-[[2-(3-methoxyphenoxy)acetyl]amino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[2-(3-methoxyphenoxy)acetyl]amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2194345 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[[2-[[2-(3-methoxyphenoxy)acetyl]amino]benzoyl]amino]benzoic acid |
| SMILES | COc1cccc(OCC(=O)Nc2ccccc2C(=O)Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H20N2O6/c1-30-17-5-4-6-18(13-17)31-14-21(26)25-20-8-3-2-7-19(20)22(27)24-16-11-9-15(10-12-16)23(28)29/h2-13H,14H2,1H3,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | BUWDNGGIMVSCOW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |