C25H25ClN4O3 — CID 46508954
[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 46508954) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46508954 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)nc1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H25ClN4O3/c26-23-11-6-20(16-27-23)25(32)33-18-24(31)28-21-7-9-22(10-8-21)30-14-12-29(13-15-30)17-19-4-2-1-3-5-19/h1-11,16H,12-15,17-18H2,(H,28,31) |
| InChIKey | AMSUOOZNXRDFAB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|