C27H31N5O4 — CID 16610854
[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 16610854) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate.
| Compound Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16610854 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)ccc1=O |
| InChI | InChI=1S/C27H31N5O4/c1-2-14-32-26(34)13-12-24(29-32)27(35)36-20-25(33)28-22-8-10-23(11-9-22)31-17-15-30(16-18-31)19-21-6-4-3-5-7-21/h3-13H,2,14-20H2,1H3,(H,28,33) |
| InChIKey | VFKNZPYQSPFKFT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|