C16H17N3O4 — CID 18080248
(2-anilino-2-oxoethyl) 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 18080248) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 6-oxo-1-propylpyridazine-3-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 6-oxo-1-propylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18080248 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2-anilino-2-oxoethyl) 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2ccccc2)ccc1=O |
| InChI | InChI=1S/C16H17N3O4/c1-2-10-19-15(21)9-8-13(18-19)16(22)23-11-14(20)17-12-6-4-3-5-7-12/h3-9H,2,10-11H2,1H3,(H,17,20) |
| InChIKey | YKGKUCYAWWUYFA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |