C25H27N3O5 — CID 27426793
[2-(4-tert-butylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 27426793) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 27426793 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | CC(C)(C)c1ccc(NC(=O)COC(=O)c2ccc(=O)n(CCOc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-25(2,3)18-9-11-19(12-10-18)26-22(29)17-33-24(31)21-13-14-23(30)28(27-21)15-16-32-20-7-5-4-6-8-20/h4-14H,15-17H2,1-3H3,(H,26,29) |
| InChIKey | PFAKVWHXDKWOLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |