C21H19N3O5 — CID 46552248
(4-acetamidophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 46552248) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is (4-acetamidophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
| Compound Name | (4-acetamidophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 46552248 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (4-acetamidophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc(=O)n(CCOc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-15(25)22-16-7-9-18(10-8-16)29-21(27)19-11-12-20(26)24(23-19)13-14-28-17-5-3-2-4-6-17/h2-12H,13-14H2,1H3,(H,22,25) |
| InChIKey | UWQBWDMQIMCXNF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|