C20H17F2N3O3S — CID 46595694
N-[4-(difluoromethylsulfanyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 46595694) has the molecular formula C20H17F2N3O3S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46595694 |
| Molecular Formula | C20H17F2N3O3S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C20H17F2N3O3S/c21-20(22)29-16-8-6-14(7-9-16)23-19(27)17-10-11-18(26)25(24-17)12-13-28-15-4-2-1-3-5-15/h1-11,20H,12-13H2,(H,23,27) |
| InChIKey | BEBDMULXWSCICY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |