C19H13Cl3N2O4 — CID 32615981
(2,4,6-trichlorophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 32615981) has the molecular formula C19H13Cl3N2O4 and a molecular weight of 439.68 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 32615981 |
| Molecular Formula | C19H13Cl3N2O4 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | (2,4,6-trichlorophenyl) 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C19H13Cl3N2O4/c20-12-10-14(21)18(15(22)11-12)28-19(26)16-6-7-17(25)24(23-16)8-9-27-13-4-2-1-3-5-13/h1-7,10-11H,8-9H2 |
| InChIKey | DBFLTZHVWWHWFF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|