About 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate
2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 47069511) has the molecular formula C18H18N4O4
and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| PubChem CID | 47069511 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | O=C(OCCn1cccn1)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N4O4/c23-17-8-7-16(18(24)26-13-11-21-10-4-9-19-21)20-22(17)12-14-25-15-5-2-1-3-6-15/h1-10H,11-14H2 |
| InChIKey | SVPIWDWSJPYUCG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate?
The IUPAC name of 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (CID 47069511) is 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
What is the SMILES notation for 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate?
The canonical SMILES for 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate is O=C(OCCn1cccn1)c1ccc(=O)n(CCOc2ccccc2)n1.
What is the InChIKey of 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate?
The InChIKey is SVPIWDWSJPYUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O4/c23-17-8-7-16(18(24)26-13-11-21-10-4-9-19-21)20-22(17)12-14-25-15-5-2-1-3-6-15/h1-10H,11-14H2.
What are the key properties of 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate?
2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate has a molecular weight of 354.37 g/mol, XLogP of 1.38, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylethyl 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate is sourced from PubChem (CID 47069511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).