C23H23N3O5 — CID 46628831
[2-(N-ethylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 46628831) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-(N-ethylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
| Compound Name | [2-(N-ethylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 46628831 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-(N-ethylanilino)-2-oxoethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(=O)n(CCOc2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O5/c1-2-25(18-9-5-3-6-10-18)22(28)17-31-23(29)20-13-14-21(27)26(24-20)15-16-30-19-11-7-4-8-12-19/h3-14H,2,15-17H2,1H3 |
| InChIKey | PWJFNQVNCNWUQB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |