C29H23N3O5 — CID 32615436
[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate (PubChem CID 32615436) has the molecular formula C29H23N3O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate.
| Compound Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 32615436 |
| Molecular Formula | C29H23N3O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxylate |
| SMILES | O=C(OCC(=O)c1c(-c2ccccc2)[nH]c2ccccc12)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C29H23N3O5/c33-25(27-22-13-7-8-14-23(22)30-28(27)20-9-3-1-4-10-20)19-37-29(35)24-15-16-26(34)32(31-24)17-18-36-21-11-5-2-6-12-21/h1-16,30H,17-19H2 |
| InChIKey | IROPQISDUMCXIZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |